C42H72O10 — CID 134730635
[(2R)-2-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E,12E)-octadeca-6,9,12-trienoate (PubChem CID 134730635) has the molecular formula C42H72O10 and a molecular weight of 737.03 g/mol. Its IUPAC name is [(2R)-2-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E,12E)-octadeca-6,9,12-trienoate.
| Compound Name | [(2R)-2-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 134730635 |
| Molecular Formula | C42H72O10 |
| Molecular Weight | 737.03 g/mol |
| Exact Mass | 736.51 |
| IUPAC Name | [(2R)-2-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@@H](CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O)OC(=O)CCCCCCC/C=C/CCCCC |
| InChI | InChI=1S/C42H72O10/c1-3-5-7-9-11-13-15-17-18-19-21-22-24-26-28-30-37(44)49-33-35(34-50-42-41(48)40(47)39(46)36(32-43)52-42)51-38(45)31-29-27-25-23-20-16-14-12-10-8-6-4-2/h11-14,17-18,21-22,35-36,39-43,46-48H,3-10,15-16,19-20,23-34H2,1-2H3/b13-11+,14-12+,18-17+,22-21+/t35-,36-,39+,40?,41?,42-/m0/s1 |
| InChIKey | FRVHEINXIFSBQI-JASFXSOSSA-N |
| XLogP | 7.71 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.03 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|