C51H84O10 — CID 134737651
[(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate (PubChem CID 134737651) has the molecular formula C51H84O10 and a molecular weight of 857.22 g/mol. Its IUPAC name is [(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate.
| Compound Name | [(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 134737651 |
| Molecular Formula | C51H84O10 |
| Molecular Weight | 857.22 g/mol |
| Exact Mass | 856.61 |
| IUPAC Name | [(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@@H](CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O)OC(=O)CCCCCC/C=C/C/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C51H84O10/c1-3-5-7-9-11-13-15-17-19-21-22-24-25-27-29-31-33-35-37-39-46(53)58-42-44(43-59-51-50(57)49(56)48(55)45(41-52)61-51)60-47(54)40-38-36-34-32-30-28-26-23-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,22,24,26-29,44-45,48-52,55-57H,3-10,15-16,21,23,25,30-43H2,1-2H3/b13-11+,14-12+,19-17+,20-18+,24-22+,28-26+,29-27+/t44-,45-,48+,49?,50?,51-/m0/s1 |
| InChIKey | IEEZHPVSOFFQRC-IWFPGJSWSA-N |
| XLogP | 10.55 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.22 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|