C43H77O10P — CID 134730718
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropyl] (11E,14E)-icosa-11,14-dienoate (PubChem CID 134730718) has the molecular formula C43H77O10P and a molecular weight of 785.05 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropyl] (11E,14E)-icosa-11,14-dienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropyl] (11E,14E)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 134730718 |
| Molecular Formula | C43H77O10P |
| Molecular Weight | 785.05 g/mol |
| Exact Mass | 784.53 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropyl] (11E,14E)-icosa-11,14-dienoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C43H77O10P/c1-3-5-7-9-11-13-15-17-19-20-21-23-24-26-28-30-32-34-42(46)50-38-41(39-52-54(48,49)51-37-40(45)36-44)53-43(47)35-33-31-29-27-25-22-18-16-14-12-10-8-6-4-2/h10-13,16-19,40-41,44-45H,3-9,14-15,20-39H2,1-2H3,(H,48,49)/b12-10+,13-11+,18-16+,19-17+/t40-,41+/m0/s1 |
| InChIKey | FSNPDTRIYWLGAA-RITUMNHWSA-N |
| XLogP | 10.95 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.05 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|