C29H53O10P — CID 138120692
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 138120692) has the molecular formula C29H53O10P and a molecular weight of 592.71 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 138120692 |
| Molecular Formula | C29H53O10P |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-hexanoyloxypropan-2-yl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C29H53O10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-21-29(33)39-27(24-36-28(32)20-18-6-4-2)25-38-40(34,35)37-23-26(31)22-30/h8-9,11-12,26-27,30-31H,3-7,10,13-25H2,1-2H3,(H,34,35)/b9-8-,12-11- |
| InChIKey | APHKOARQYRSQDJ-MURFETPASA-N |
| XLogP | 5.93 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|