C46H81O10P — CID 134730749
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134730749) has the molecular formula C46H81O10P and a molecular weight of 825.12 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134730749 |
| Molecular Formula | C46H81O10P |
| Molecular Weight | 825.12 g/mol |
| Exact Mass | 824.56 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C46H81O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(49)53-41-44(42-55-57(51,52)54-40-43(48)39-47)56-46(50)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12,14,17-20,23,25,29,31,43-44,47-48H,3-11,13,15-16,21-22,24,26-28,30,32-42H2,1-2H3,(H,51,52)/b14-12+,19-17+,20-18+,25-23+,31-29+/t43-,44+/m0/s1 |
| InChIKey | FSXCTEBEDQNNMI-LKXPRKLISA-N |
| XLogP | 11.89 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.12 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|