C36H63O10P — CID 134779789
[(2S)-2-decanoyloxy-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate (PubChem CID 134779789) has the molecular formula C36H63O10P and a molecular weight of 686.86 g/mol. Its IUPAC name is [(2S)-2-decanoyloxy-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-2-decanoyloxy-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 134779789 |
| Molecular Formula | C36H63O10P |
| Molecular Weight | 686.86 g/mol |
| Exact Mass | 686.42 |
| IUPAC Name | [(2S)-2-decanoyloxy-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxypropyl] (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)OC[C@@H](COP(=O)(O)OC[C@H](O)CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C36H63O10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-23-25-27-35(39)43-31-34(32-45-47(41,42)44-30-33(38)29-37)46-36(40)28-26-24-21-10-8-6-4-2/h11-12,14-15,17-18,20,22,33-34,37-38H,3-10,13,16,19,21,23-32H2,1-2H3,(H,41,42)/b12-11+,15-14+,18-17+,22-20+/t33-,34+/m1/s1 |
| InChIKey | XTLZZSCOJSXUBS-DCQFULHDSA-N |
| XLogP | 8.21 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.86 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|