C41H72NO10P — CID 134732176
(2S)-2-amino-3-[[(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134732176) has the molecular formula C41H72NO10P and a molecular weight of 770.00 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134732176 |
| Molecular Formula | C41H72NO10P |
| Molecular Weight | 770.00 g/mol |
| Exact Mass | 769.49 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C41H72NO10P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-39(43)49-34-37(35-50-53(47,48)51-36-38(42)41(45)46)52-40(44)33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,37-38H,3-4,6,8-10,12,14-15,20-36,42H2,1-2H3,(H,45,46)(H,47,48)/b7-5+,13-11+,18-16+,19-17+/t37-,38+/m1/s1 |
| InChIKey | GFEGQMCWQRVZEW-NDEGYVCKSA-N |
| XLogP | 10.22 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.00 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|