C45H76NO8P — CID 134733319
[(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134733319) has the molecular formula C45H76NO8P and a molecular weight of 790.08 g/mol. Its IUPAC name is [(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134733319 |
| Molecular Formula | C45H76NO8P |
| Molecular Weight | 790.08 g/mol |
| Exact Mass | 789.53 |
| IUPAC Name | [(2R)-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/C/C=C/CCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C45H76NO8P/c1-6-8-10-12-14-16-18-20-22-23-24-26-28-30-32-34-36-38-45(48)54-43(42-53-55(49,50)52-40-39-46(3,4)5)41-51-44(47)37-35-33-31-29-27-25-21-19-17-15-13-11-9-7-2/h8,10,13-16,19-22,24,26,30,32,43H,6-7,9,11-12,17-18,23,25,27-29,31,33-42H2,1-5H3/b10-8+,15-13+,16-14+,21-19+,22-20+,26-24+,32-30+/t43-/m1/s1 |
| InChIKey | GQIULIXPAHRSNV-NWOVOOQNSA-N |
| XLogP | 10.99 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.08 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|