C11H13N3O3 — CID 13473446
5-hydroxy-3-methyl-2-oxo-N-phenylimidazolidine-1-carboxamide (PubChem CID 13473446) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 5-hydroxy-3-methyl-2-oxo-N-phenylimidazolidine-1-carboxamide.
| Compound Name | 5-hydroxy-3-methyl-2-oxo-N-phenylimidazolidine-1-carboxamide |
|---|---|
| PubChem CID | 13473446 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 5-hydroxy-3-methyl-2-oxo-N-phenylimidazolidine-1-carboxamide |
| SMILES | CN1CC(O)N(C(=O)Nc2ccccc2)C1=O |
| InChI | InChI=1S/C11H13N3O3/c1-13-7-9(15)14(11(13)17)10(16)12-8-5-3-2-4-6-8/h2-6,9,15H,7H2,1H3,(H,12,16) |
| InChIKey | UUBLPXHYHAVKBS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |