C56H92O6 — CID 134736801
[2-[(11E,14E)-heptadeca-11,14-dienoyl]oxy-3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134736801) has the molecular formula C56H92O6 and a molecular weight of 861.35 g/mol. Its IUPAC name is [2-[(11E,14E)-heptadeca-11,14-dienoyl]oxy-3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [2-[(11E,14E)-heptadeca-11,14-dienoyl]oxy-3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134736801 |
| Molecular Formula | C56H92O6 |
| Molecular Weight | 861.35 g/mol |
| Exact Mass | 860.69 |
| IUPAC Name | [2-[(11E,14E)-heptadeca-11,14-dienoyl]oxy-3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OCC(COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)OC(=O)CCCCCCCCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C56H92O6/c1-4-7-10-13-16-19-22-25-27-28-29-32-34-37-40-43-46-49-55(58)61-52-53(51-60-54(57)48-45-42-39-36-33-30-24-21-18-15-12-9-6-3)62-56(59)50-47-44-41-38-35-31-26-23-20-17-14-11-8-5-2/h8-9,11-12,15,17-18,20-21,24-25,27,29,32,37,40,53H,4-7,10,13-14,16,19,22-23,26,28,30-31,33-36,38-39,41-52H2,1-3H3/b11-8+,12-9+,18-15+,20-17+,24-21+,27-25+,32-29+,40-37+ |
| InChIKey | HWAIOLABFTWCIM-DVGZCCGCSA-N |
| XLogP | 16.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.35 |
| LogP ≤ 5 | 16.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|