C49H74O6 — CID 138302979
[3-[(Z)-dodec-5-enoyl]oxy-2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (7Z,9E,11Z,13Z,15Z,17Z)-icosa-7,9,11,13,15,17-hexaenoate (PubChem CID 138302979) has the molecular formula C49H74O6 and a molecular weight of 759.13 g/mol. Its IUPAC name is [3-[(Z)-dodec-5-enoyl]oxy-2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (7Z,9E,11Z,13Z,15Z,17Z)-icosa-7,9,11,13,15,17-hexaenoate.
| Compound Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (7Z,9E,11Z,13Z,15Z,17Z)-icosa-7,9,11,13,15,17-hexaenoate |
|---|---|
| PubChem CID | 138302979 |
| Molecular Formula | C49H74O6 |
| Molecular Weight | 759.13 g/mol |
| Exact Mass | 758.55 |
| IUPAC Name | [3-[(Z)-dodec-5-enoyl]oxy-2-[(5Z,8Z,11Z)-tetradeca-5,8,11-trienoyl]oxypropyl] (7Z,9E,11Z,13Z,15Z,17Z)-icosa-7,9,11,13,15,17-hexaenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/C=C/C=C\CCCCCC(=O)OCC(COC(=O)CCC/C=C\CCCCCC)OC(=O)CCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C49H74O6/c1-4-7-10-13-16-19-21-22-23-24-25-26-28-30-33-36-39-42-48(51)54-45-46(44-53-47(50)41-38-35-32-29-18-15-12-9-6-3)55-49(52)43-40-37-34-31-27-20-17-14-11-8-5-2/h7-8,10-11,13,16-17,19-26,28-29,31-32,34,46H,4-6,9,12,14-15,18,27,30,33,35-45H2,1-3H3/b10-7-,11-8-,16-13-,20-17-,21-19-,23-22-,25-24+,28-26-,32-29-,34-31- |
| InChIKey | YCFSLWZCYVSATF-JHDGLAHKSA-N |
| XLogP | 13.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.13 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|