C39H73O8P — CID 134738136
[(2R)-1-[(E)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (E)-octadec-9-enoate (PubChem CID 134738136) has the molecular formula C39H73O8P and a molecular weight of 700.98 g/mol. Its IUPAC name is [(2R)-1-[(E)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (E)-octadec-9-enoate.
| Compound Name | [(2R)-1-[(E)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 134738136 |
| Molecular Formula | C39H73O8P |
| Molecular Weight | 700.98 g/mol |
| Exact Mass | 700.50 |
| IUPAC Name | [(2R)-1-[(E)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (E)-octadec-9-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C39H73O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40)45-35-37(36-46-48(42,43)44)47-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h13,15,18,20,37H,3-12,14,16-17,19,21-36H2,1-2H3,(H2,42,43,44)/b15-13+,20-18+/t37-/m1/s1 |
| InChIKey | IIMFLKINUHKKSA-YBQYFCMVSA-N |
| XLogP | 11.63 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.98 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|