C49H86O12S — CID 134740782
[(2S,3S,6S)-6-[(2S)-2,3-bis[[(11E,14E)-icosa-11,14-dienoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid (PubChem CID 134740782) has the molecular formula C49H86O12S and a molecular weight of 899.28 g/mol. Its IUPAC name is [(2S,3S,6S)-6-[(2S)-2,3-bis[[(11E,14E)-icosa-11,14-dienoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,6S)-6-[(2S)-2,3-bis[[(11E,14E)-icosa-11,14-dienoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 134740782 |
| Molecular Formula | C49H86O12S |
| Molecular Weight | 899.28 g/mol |
| Exact Mass | 898.58 |
| IUPAC Name | [(2S,3S,6S)-6-[(2S)-2,3-bis[[(11E,14E)-icosa-11,14-dienoyl]oxy]propoxy]-3,4,5-trihydroxyoxan-2-yl]methanesulfonic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OC[C@H](CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)C(O)C1O)OC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C49H86O12S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(50)58-39-42(40-59-49-48(54)47(53)46(52)43(61-49)41-62(55,56)57)60-45(51)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,42-43,46-49,52-54H,3-10,15-16,21-41H2,1-2H3,(H,55,56,57)/b13-11+,14-12+,19-17+,20-18+/t42-,43-,46-,47?,48?,49+/m1/s1 |
| InChIKey | JFUOBQOGUSADFR-SHHZGGASSA-N |
| XLogP | 10.34 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.28 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|