C47H84O12S — CID 134753926
[(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(E)-octadec-7-enoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid (PubChem CID 134753926) has the molecular formula C47H84O12S and a molecular weight of 873.24 g/mol. Its IUPAC name is [(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(E)-octadec-7-enoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid.
| Compound Name | [(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(E)-octadec-7-enoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 134753926 |
| Molecular Formula | C47H84O12S |
| Molecular Weight | 873.24 g/mol |
| Exact Mass | 872.57 |
| IUPAC Name | [(2S,3S,6S)-3,4,5-trihydroxy-6-[(2S)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(E)-octadec-7-enoyl]oxypropoxy]oxan-2-yl]methanesulfonic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OC[C@H](CO[C@H]1O[C@H](CS(=O)(=O)O)[C@@H](O)C(O)C1O)OC(=O)CCCCC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C47H84O12S/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(48)56-37-40(38-57-47-46(52)45(51)44(50)41(59-47)39-60(53,54)55)58-43(49)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h11,13,17,19,24,26,40-41,44-47,50-52H,3-10,12,14-16,18,20-23,25,27-39H2,1-2H3,(H,53,54,55)/b13-11+,19-17+,26-24+/t40-,41-,44-,45?,46?,47+/m1/s1 |
| InChIKey | NWHSXMKKDHEOFA-QUJINABTSA-N |
| XLogP | 9.78 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.24 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|