C47H78NO7+ — CID 134741171
[1-carboxy-3-[3-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134741171) has the molecular formula C47H78NO7+ and a molecular weight of 769.14 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134741171 |
| Molecular Formula | C47H78NO7+ |
| Molecular Weight | 769.14 g/mol |
| Exact Mass | 768.58 |
| IUPAC Name | [1-carboxy-3-[3-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCCCCC/C=C/C=C/C=C/C=C/CCCCC |
| InChI | InChI=1S/C47H77NO7/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-27-29-31-33-35-37-45(49)54-42-43(41-53-40-39-44(47(51)52)48(3,4)5)55-46(50)38-36-34-32-30-28-25-19-17-15-13-11-9-7-2/h9,11,13-24,43-44H,6-8,10,12,25-42H2,1-5H3/p+1/b11-9+,15-13+,16-14+,19-17+,20-18+,22-21+,24-23+ |
| InChIKey | JJSXSBLZBBJOBS-BBWKCUAISA-O |
| XLogP | 11.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.14 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|