C41H68NO7+ — CID 134757326
[1-carboxy-3-[3-[(7E,9E,11E,13E,15E,17E)-icosa-7,9,11,13,15,17-hexaenoyl]oxy-2-undecanoyloxypropoxy]propyl]-trimethylazanium (PubChem CID 134757326) has the molecular formula C41H68NO7+ and a molecular weight of 687.00 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(7E,9E,11E,13E,15E,17E)-icosa-7,9,11,13,15,17-hexaenoyl]oxy-2-undecanoyloxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(7E,9E,11E,13E,15E,17E)-icosa-7,9,11,13,15,17-hexaenoyl]oxy-2-undecanoyloxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134757326 |
| Molecular Formula | C41H68NO7+ |
| Molecular Weight | 687.00 g/mol |
| Exact Mass | 686.50 |
| IUPAC Name | [1-carboxy-3-[3-[(7E,9E,11E,13E,15E,17E)-icosa-7,9,11,13,15,17-hexaenoyl]oxy-2-undecanoyloxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C41H67NO7/c1-6-8-10-12-14-16-17-18-19-20-21-22-23-24-26-27-29-31-39(43)48-36-37(35-47-34-33-38(41(45)46)42(3,4)5)49-40(44)32-30-28-25-15-13-11-9-7-2/h8,10,12,14,16-23,37-38H,6-7,9,11,13,15,24-36H2,1-5H3/p+1/b10-8+,14-12+,17-16+,19-18+,21-20+,23-22+ |
| InChIKey | PBOPRSARQPUSPG-UIKCKPBCSA-O |
| XLogP | 9.24 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.00 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|