C46H83NO8P+ — CID 134741362
2-[hydroxy-[(2R)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(9E,11E)-octadeca-9,11-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 134741362) has the molecular formula C46H83NO8P+ and a molecular weight of 809.14 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(9E,11E)-octadeca-9,11-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(9E,11E)-octadeca-9,11-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134741362 |
| Molecular Formula | C46H83NO8P+ |
| Molecular Weight | 809.14 g/mol |
| Exact Mass | 808.59 |
| IUPAC Name | 2-[hydroxy-[(2R)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(9E,11E)-octadeca-9,11-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H82NO8P/c1-6-8-10-12-14-16-18-20-22-23-25-26-28-30-32-34-36-38-45(48)52-42-44(43-54-56(50,51)53-41-40-47(3,4)5)55-46(49)39-37-35-33-31-29-27-24-21-19-17-15-13-11-9-7-2/h17,19-22,24-26,30,32,44H,6-16,18,23,27-29,31,33-43H2,1-5H3/p+1/b19-17+,22-20+,24-21+,26-25+,32-30+/t44-/m1/s1 |
| InChIKey | JLFOLGSYJDHJFC-LAYIWPNGSA-O |
| XLogP | 12.46 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.14 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|