C43H79NO8P+ — CID 134779772
2-[[2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134779772) has the molecular formula C43H79NO8P+ and a molecular weight of 769.08 g/mol. Its IUPAC name is 2-[[2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134779772 |
| Molecular Formula | C43H79NO8P+ |
| Molecular Weight | 769.08 g/mol |
| Exact Mass | 768.55 |
| IUPAC Name | 2-[[2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C/C/C=C/CCC(=O)OC(COC(=O)CCCCC/C=C/C=C/CCCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C43H78NO8P/c1-6-8-10-12-14-16-18-20-21-22-24-25-27-29-31-33-35-42(45)49-39-41(40-51-53(47,48)50-38-37-44(3,4)5)52-43(46)36-34-32-30-28-26-23-19-17-15-13-11-9-7-2/h21-26,30,32,41H,6-20,27-29,31,33-40H2,1-5H3/p+1/b22-21+,25-24+,26-23+,32-30+ |
| InChIKey | XTHVEVKBKCCGOK-FMWDXIERSA-O |
| XLogP | 11.52 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.08 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|