C36H60O5 — CID 134742032
[(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 134742032) has the molecular formula C36H60O5 and a molecular weight of 572.87 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 134742032 |
| Molecular Formula | C36H60O5 |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.44 |
| IUPAC Name | [(2S)-1-hydroxy-3-undecanoyloxypropan-2-yl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C36H60O5/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-23-25-27-29-31-36(39)41-34(32-37)33-40-35(38)30-28-26-24-12-10-8-6-4-2/h5,7,11,13,15-16,18-19,21-22,34,37H,3-4,6,8-10,12,14,17,20,23-33H2,1-2H3/b7-5+,13-11+,16-15+,19-18+,22-21+/t34-/m0/s1 |
| InChIKey | JRFQABVTRNPZGC-GBNYVQRISA-N |
| XLogP | 9.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|