C46H74NO7+ — CID 134743306
[1-carboxy-3-[3-[(7E,9E,11E,13E,15E)-octadeca-7,9,11,13,15-pentaenoyl]oxy-2-[(11E,13E,15E)-octadeca-11,13,15-trienoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134743306) has the molecular formula C46H74NO7+ and a molecular weight of 753.10 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(7E,9E,11E,13E,15E)-octadeca-7,9,11,13,15-pentaenoyl]oxy-2-[(11E,13E,15E)-octadeca-11,13,15-trienoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(7E,9E,11E,13E,15E)-octadeca-7,9,11,13,15-pentaenoyl]oxy-2-[(11E,13E,15E)-octadeca-11,13,15-trienoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134743306 |
| Molecular Formula | C46H74NO7+ |
| Molecular Weight | 753.10 g/mol |
| Exact Mass | 752.55 |
| IUPAC Name | [1-carboxy-3-[3-[(7E,9E,11E,13E,15E)-octadeca-7,9,11,13,15-pentaenoyl]oxy-2-[(11E,13E,15E)-octadeca-11,13,15-trienoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C/C=C/C=C/CC |
| InChI | InChI=1S/C46H73NO7/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-44(48)53-41-42(40-52-39-38-43(46(50)51)47(3,4)5)54-45(49)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-20,22,24,26,42-43H,6-7,21,23,25,27-41H2,1-5H3/p+1/b10-8+,11-9+,14-12+,15-13+,18-16+,19-17+,22-20+,26-24+ |
| InChIKey | KDBQJKOGJDTVPI-CHTGRWFKSA-O |
| XLogP | 10.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.10 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|