C39H71O8P — CID 134744133
[(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (E)-octadec-9-enoate (PubChem CID 134744133) has the molecular formula C39H71O8P and a molecular weight of 698.96 g/mol. Its IUPAC name is [(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (E)-octadec-9-enoate.
| Compound Name | [(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 134744133 |
| Molecular Formula | C39H71O8P |
| Molecular Weight | 698.96 g/mol |
| Exact Mass | 698.49 |
| IUPAC Name | [(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (E)-octadec-9-enoate |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C39H71O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40)45-35-37(36-46-48(42,43)44)47-39(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h14,16-20,37H,3-13,15,21-36H2,1-2H3,(H2,42,43,44)/b16-14+,19-17+,20-18+/t37-/m1/s1 |
| InChIKey | KKNQYQIKVNWZQQ-KLSHYCTDSA-N |
| XLogP | 11.40 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.96 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|