C38H67O13P — CID 134745080
[(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate (PubChem CID 134745080) has the molecular formula C38H67O13P and a molecular weight of 762.91 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 134745080 |
| Molecular Formula | C38H67O13P |
| Molecular Weight | 762.91 g/mol |
| Exact Mass | 762.43 |
| IUPAC Name | [(2R)-1-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-3-undecanoyloxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C38H67O13P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-32(40)50-30(28-48-31(39)26-24-22-20-12-10-8-6-4-2)29-49-52(46,47)51-38-36(44)34(42)33(41)35(43)37(38)45/h5,7,11,13,15-16,30,33-38,41-45H,3-4,6,8-10,12,14,17-29H2,1-2H3,(H,46,47)/b7-5+,13-11+,16-15+/t30-,33?,34-,35?,36?,37?,38?/m1/s1 |
| InChIKey | KTIKDRYBQCCSCT-KLOBRHTGSA-N |
| XLogP | 5.88 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|