C35H55O8P — CID 134745924
[1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate (PubChem CID 134745924) has the molecular formula C35H55O8P and a molecular weight of 634.79 g/mol. Its IUPAC name is [1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate.
| Compound Name | [1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 134745924 |
| Molecular Formula | C35H55O8P |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.36 |
| IUPAC Name | [1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCCCCCC/C=C/C=C/C=C/CC |
| InChI | InChI=1S/C35H55O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(36)41-31-33(32-42-44(38,39)40)43-35(37)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-17,19,33H,3-4,18,20-32H2,1-2H3,(H2,38,39,40)/b7-5+,8-6+,11-9+,12-10+,15-13+,16-14+,19-17+ |
| InChIKey | LBPIRSMCBIOETC-VDFZJUKXSA-N |
| XLogP | 8.95 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|