C35H61O8P — CID 134745608
[2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-phosphonooxypropyl] (E)-hexadec-7-enoate (PubChem CID 134745608) has the molecular formula C35H61O8P and a molecular weight of 640.84 g/mol. Its IUPAC name is [2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-phosphonooxypropyl] (E)-hexadec-7-enoate.
| Compound Name | [2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-phosphonooxypropyl] (E)-hexadec-7-enoate |
|---|---|
| PubChem CID | 134745608 |
| Molecular Formula | C35H61O8P |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.41 |
| IUPAC Name | [2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-phosphonooxypropyl] (E)-hexadec-7-enoate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COC(=O)CCCCC/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C35H61O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34(36)41-31-33(32-42-44(38,39)40)43-35(37)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,10,12,14,16-17,19,33H,3-5,7,9,11,13,15,18,20-32H2,1-2H3,(H2,38,39,40)/b8-6+,12-10+,16-14+,19-17+ |
| InChIKey | KYRLDRNEILHHDS-VKJACBKQSA-N |
| XLogP | 9.62 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|