C38H64O5 — CID 134747242
[(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate (PubChem CID 134747242) has the molecular formula C38H64O5 and a molecular weight of 600.93 g/mol. Its IUPAC name is [(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | [(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 134747242 |
| Molecular Formula | C38H64O5 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 600.48 |
| IUPAC Name | [(2S)-1-[(E)-heptadec-9-enoyl]oxy-3-hydroxypropan-2-yl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C38H64O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36(34-39)35-42-37(40)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,23,25,36,39H,3-4,6,8-10,12,14-15,20-22,24,26-35H2,1-2H3/b7-5+,13-11+,18-16+,19-17+,25-23+/t36-/m0/s1 |
| InChIKey | LNCZNZODPZWOAC-LOPDBLRQSA-N |
| XLogP | 10.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|