C38H65O10P — CID 134750919
[3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (E)-hexadec-7-enoate (PubChem CID 134750919) has the molecular formula C38H65O10P and a molecular weight of 712.90 g/mol. Its IUPAC name is [3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (E)-hexadec-7-enoate.
| Compound Name | [3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (E)-hexadec-7-enoate |
|---|---|
| PubChem CID | 134750919 |
| Molecular Formula | C38H65O10P |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.43 |
| IUPAC Name | [3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (E)-hexadec-7-enoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCC/C=C/CCCCCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C38H65O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-37(41)45-33-36(34-47-49(43,44)46-32-35(40)31-39)48-38(42)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,10,12,14,16-20,35-36,39-40H,3-5,7,9,11,13,15,21-34H2,1-2H3,(H,43,44)/b8-6+,12-10+,16-14+,19-17+,20-18+/t35-,36?/m0/s1 |
| InChIKey | MUYXQRBSFOCBPS-UHBYLLSTSA-N |
| XLogP | 8.77 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|