C33H55O10P — CID 134781630
[1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-undec-4-enoyl]oxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate (PubChem CID 134781630) has the molecular formula C33H55O10P and a molecular weight of 642.77 g/mol. Its IUPAC name is [1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-undec-4-enoyl]oxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate.
| Compound Name | [1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-undec-4-enoyl]oxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 134781630 |
| Molecular Formula | C33H55O10P |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | [1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-undec-4-enoyl]oxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CC/C=C/CCCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C33H55O10P/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-33(37)43-31(29-42-44(38,39)41-27-30(35)26-34)28-40-32(36)24-22-20-18-12-10-8-6-4-2/h5,7,9,11,13-16,18,20,30-31,34-35H,3-4,6,8,10,12,17,19,21-29H2,1-2H3,(H,38,39)/b7-5+,11-9+,14-13+,16-15+,20-18+/t30-,31?/m0/s1 |
| InChIKey | YLELSCHTJITDBY-XPHWETISSA-N |
| XLogP | 6.82 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|