C41H77O8P — CID 134754229
[(2R)-2-[(E)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate (PubChem CID 134754229) has the molecular formula C41H77O8P and a molecular weight of 729.03 g/mol. Its IUPAC name is [(2R)-2-[(E)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate.
| Compound Name | [(2R)-2-[(E)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134754229 |
| Molecular Formula | C41H77O8P |
| Molecular Weight | 729.03 g/mol |
| Exact Mass | 728.54 |
| IUPAC Name | [(2R)-2-[(E)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (E)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C41H77O8P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-40(42)47-37-39(38-48-50(44,45)46)49-41(43)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h17-19,21,39H,3-16,20,22-38H2,1-2H3,(H2,44,45,46)/b19-17+,21-18+/t39-/m1/s1 |
| InChIKey | NZEIAQPLOUBOHI-FBWUSRCCSA-N |
| XLogP | 12.41 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.03 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|