C40H60NO8P — CID 134755208
2,3-bis[[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134755208) has the molecular formula C40H60NO8P and a molecular weight of 713.89 g/mol. Its IUPAC name is 2,3-bis[[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2,3-bis[[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134755208 |
| Molecular Formula | C40H60NO8P |
| Molecular Weight | 713.89 g/mol |
| Exact Mass | 713.41 |
| IUPAC Name | 2,3-bis[[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxy]propyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/CCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCC/C=C/C=C/C=C/C=C/C=C/CC |
| InChI | InChI=1S/C40H60NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-39(42)46-36-38(37-48-50(44,45)47-35-34-41(3,4)5)49-40(43)33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-27,38H,6-7,28-37H2,1-5H3/b10-8+,11-9+,14-12+,15-13+,18-16+,19-17+,22-20+,23-21+,26-24+,27-25+ |
| InChIKey | OHZWZZWNPWSCOZ-MOPHSAIUSA-N |
| XLogP | 8.37 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.89 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|