C41H72O10 — CID 134757278
[(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E)-octadeca-9,11-dienoate (PubChem CID 134757278) has the molecular formula C41H72O10 and a molecular weight of 725.02 g/mol. Its IUPAC name is [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E)-octadeca-9,11-dienoate.
| Compound Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E)-octadeca-9,11-dienoate |
|---|---|
| PubChem CID | 134757278 |
| Molecular Formula | C41H72O10 |
| Molecular Weight | 725.02 g/mol |
| Exact Mass | 724.51 |
| IUPAC Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E)-octadeca-9,11-dienoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CCCCCCC/C=C/C=C/CCCCCC |
| InChI | InChI=1S/C41H72O10/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-28-30-37(44)50-34(33-49-41-40(47)39(46)38(45)35(31-42)51-41)32-48-36(43)29-27-25-23-21-19-14-12-10-8-6-4-2/h10,12-13,15-17,34-35,38-42,45-47H,3-9,11,14,18-33H2,1-2H3/b12-10+,15-13+,17-16+/t34-,35-,38+,39?,40?,41-/m1/s1 |
| InChIKey | PBDUSUIHMYOICH-MJTSYRQNSA-N |
| XLogP | 7.55 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.02 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|