C38H68O10 — CID 134772548
[(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-pentadec-9-enoate (PubChem CID 134772548) has the molecular formula C38H68O10 and a molecular weight of 684.95 g/mol. Its IUPAC name is [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-pentadec-9-enoate.
| Compound Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-pentadec-9-enoate |
|---|---|
| PubChem CID | 134772548 |
| Molecular Formula | C38H68O10 |
| Molecular Weight | 684.95 g/mol |
| Exact Mass | 684.48 |
| IUPAC Name | [(2S)-1-[(E)-tetradec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-pentadec-9-enoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O)OC(=O)CCCCCCC/C=C/CCCCC |
| InChI | InChI=1S/C38H68O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-34(41)47-31(30-46-38-37(44)36(43)35(42)32(28-39)48-38)29-45-33(40)26-24-22-20-18-16-14-12-10-8-6-4-2/h10-13,31-32,35-39,42-44H,3-9,14-30H2,1-2H3/b12-10+,13-11+/t31-,32-,35+,36?,37?,38-/m1/s1 |
| InChIKey | VCHQDLVGQCTGFX-GODQISHWSA-N |
| XLogP | 6.60 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.95 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|