C45H82O10 — CID 138127442
[1-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate (PubChem CID 138127442) has the molecular formula C45H82O10 and a molecular weight of 783.14 g/mol. Its IUPAC name is [1-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate.
| Compound Name | [1-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate |
|---|---|
| PubChem CID | 138127442 |
| Molecular Formula | C45H82O10 |
| Molecular Weight | 783.14 g/mol |
| Exact Mass | 782.59 |
| IUPAC Name | [1-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-henicos-11-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OCC(COC1OC(CO)C(O)C(O)C1O)OC(=O)CCCCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C45H82O10/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-26-28-30-32-34-41(48)54-38(37-53-45-44(51)43(50)42(49)39(35-46)55-45)36-52-40(47)33-31-29-27-25-23-16-14-12-10-8-6-4-2/h12,14,18-19,38-39,42-46,49-51H,3-11,13,15-17,20-37H2,1-2H3/b14-12-,19-18- |
| InChIKey | BKGPXHUEYBGILZ-DUZKARGPSA-N |
| XLogP | 9.33 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.14 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|