C39H70O10 — CID 138316270
[2-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-pentadec-9-enoate (PubChem CID 138316270) has the molecular formula C39H70O10 and a molecular weight of 698.98 g/mol. Its IUPAC name is [2-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-pentadec-9-enoate.
| Compound Name | [2-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 138316270 |
| Molecular Formula | C39H70O10 |
| Molecular Weight | 698.98 g/mol |
| Exact Mass | 698.50 |
| IUPAC Name | [2-[(Z)-pentadec-9-enoyl]oxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (Z)-pentadec-9-enoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OCC(COC1OC(CO)C(O)C(O)C1O)OC(=O)CCCCCCC/C=C\CCCCC |
| InChI | InChI=1S/C39H70O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-34(41)46-30-32(31-47-39-38(45)37(44)36(43)33(29-40)49-39)48-35(42)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,32-33,36-40,43-45H,3-10,15-31H2,1-2H3/b13-11-,14-12- |
| InChIKey | ZROJAIJPOBTXDM-XSYHWHKQSA-N |
| XLogP | 6.99 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.98 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|