C47H86O10 — CID 134744974
[(2S)-1-[(E)-octadec-7-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-icos-11-enoate (PubChem CID 134744974) has the molecular formula C47H86O10 and a molecular weight of 811.19 g/mol. Its IUPAC name is [(2S)-1-[(E)-octadec-7-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-icos-11-enoate.
| Compound Name | [(2S)-1-[(E)-octadec-7-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134744974 |
| Molecular Formula | C47H86O10 |
| Molecular Weight | 811.19 g/mol |
| Exact Mass | 810.62 |
| IUPAC Name | [(2S)-1-[(E)-octadec-7-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (E)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCC/C=C/CCCCCCCCCC)CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C47H86O10/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-43(50)56-40(39-55-47-46(53)45(52)44(51)41(37-48)57-47)38-54-42(49)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h17,19,23,25,40-41,44-48,51-53H,3-16,18,20-22,24,26-39H2,1-2H3/b19-17+,25-23+/t40-,41-,44+,45?,46?,47-/m1/s1 |
| InChIKey | KSMNRARCMXFZFH-HYXLWGFPSA-N |
| XLogP | 10.11 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.19 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|