C31H59NO3 — CID 134760738
(E)-N-[(E,2S,3R)-1,3-dihydroxytetradec-4-en-2-yl]heptadec-9-enamide (PubChem CID 134760738) has the molecular formula C31H59NO3 and a molecular weight of 493.82 g/mol. Its IUPAC name is (E)-N-[(E,2S,3R)-1,3-dihydroxytetradec-4-en-2-yl]heptadec-9-enamide.
| Compound Name | (E)-N-[(E,2S,3R)-1,3-dihydroxytetradec-4-en-2-yl]heptadec-9-enamide |
|---|---|
| PubChem CID | 134760738 |
| Molecular Formula | C31H59NO3 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 493.45 |
| IUPAC Name | (E)-N-[(E,2S,3R)-1,3-dihydroxytetradec-4-en-2-yl]heptadec-9-enamide |
| SMILES | CCCCCCC/C=C/CCCCCCCC(=O)N[C@@H](CO)[C@H](O)/C=C/CCCCCCCCC |
| InChI | InChI=1S/C31H59NO3/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-27-31(35)32-29(28-33)30(34)26-24-22-20-18-12-10-8-6-4-2/h14-15,24,26,29-30,33-34H,3-13,16-23,25,27-28H2,1-2H3,(H,32,35)/b15-14+,26-24+/t29-,30+/m0/s1 |
| InChIKey | QGNVUABWHCEZKZ-WXJACKNBSA-N |
| XLogP | 8.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|