C34H65NO3 — CID 138232599
(Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]nonadec-9-enamide (PubChem CID 138232599) has the molecular formula C34H65NO3 and a molecular weight of 535.90 g/mol. Its IUPAC name is (Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]nonadec-9-enamide.
| Compound Name | (Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]nonadec-9-enamide |
|---|---|
| PubChem CID | 138232599 |
| Molecular Formula | C34H65NO3 |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 535.50 |
| IUPAC Name | (Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]nonadec-9-enamide |
| SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)NC(CO)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C34H65NO3/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-30-34(38)35-32(31-36)33(37)29-27-25-23-21-14-12-10-8-6-4-2/h17-18,27,29,32-33,36-37H,3-16,19-26,28,30-31H2,1-2H3,(H,35,38)/b18-17-,29-27+ |
| InChIKey | OYWJPQFSHNQUFM-VFQHSQPTSA-N |
| XLogP | 9.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|