C46H81NO9P+ — CID 134763313
2-[hydroxy-[2-[(5Z,8Z,11Z,15E,17Z)-14-hydroxyicosa-5,8,11,15,17-pentaenoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 134763313) has the molecular formula C46H81NO9P+ and a molecular weight of 823.13 g/mol. Its IUPAC name is 2-[hydroxy-[2-[(5Z,8Z,11Z,15E,17Z)-14-hydroxyicosa-5,8,11,15,17-pentaenoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[2-[(5Z,8Z,11Z,15E,17Z)-14-hydroxyicosa-5,8,11,15,17-pentaenoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134763313 |
| Molecular Formula | C46H81NO9P+ |
| Molecular Weight | 823.13 g/mol |
| Exact Mass | 822.56 |
| IUPAC Name | 2-[hydroxy-[2-[(5Z,8Z,11Z,15E,17Z)-14-hydroxyicosa-5,8,11,15,17-pentaenoyl]oxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C\C=C\C(O)C/C=C\C/C=C\C/C=C\CCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H80NO9P/c1-6-8-10-12-13-14-15-16-17-18-19-23-26-29-33-37-45(49)53-41-44(42-55-57(51,52)54-40-39-47(3,4)5)56-46(50)38-34-30-27-24-21-20-22-25-28-32-36-43(48)35-31-11-9-7-2/h9,11,16-17,20,22,24,27-28,31-32,35,43-44,48H,6-8,10,12-15,18-19,21,23,25-26,29-30,33-34,36-42H2,1-5H3/p+1/b11-9-,17-16-,22-20-,27-24-,32-28-,35-31+ |
| InChIKey | RDNRVSDISRUMOE-IFGSGZQVSA-O |
| XLogP | 11.21 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.13 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|