C42H75NO9P+ — CID 156989195
2-[hydroxy-[(2R)-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156989195) has the molecular formula C42H75NO9P+ and a molecular weight of 769.03 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156989195 |
| Molecular Formula | C42H75NO9P+ |
| Molecular Weight | 769.03 g/mol |
| Exact Mass | 768.52 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCC/C=C/C=C\C(O)C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H74NO9P/c1-6-8-10-12-14-16-17-19-21-25-29-33-41(45)49-37-40(38-51-53(47,48)50-36-35-43(3,4)5)52-42(46)34-30-26-22-24-28-32-39(44)31-27-23-20-18-15-13-11-9-7-2/h12,14-15,18,22-24,27-28,32,39-40,44H,6-11,13,16-17,19-21,25-26,29-31,33-38H2,1-5H3/p+1/b14-12-,18-15-,24-22+,27-23-,32-28-/t39?,40-/m1/s1 |
| InChIKey | PXUQBLAEMJXEQA-LBKDZYTFSA-O |
| XLogP | 9.87 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.03 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|