C38H70NO8P — CID 134763519
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] (E)-heptadec-7-enoate (PubChem CID 134763519) has the molecular formula C38H70NO8P and a molecular weight of 699.95 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] (E)-heptadec-7-enoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] (E)-heptadec-7-enoate |
|---|---|
| PubChem CID | 134763519 |
| Molecular Formula | C38H70NO8P |
| Molecular Weight | 699.95 g/mol |
| Exact Mass | 699.48 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] (E)-heptadec-7-enoate |
| SMILES | CCCCCCCC/C=C/C/C=C/CCC(=O)OC(COC(=O)CCCCC/C=C/CCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C38H70NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-37(40)44-34-36(35-46-48(42,43)45-33-32-39)47-38(41)31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h18-21,25,27,36H,3-17,22-24,26,28-35,39H2,1-2H3,(H,42,43)/b20-19+,21-18+,27-25+ |
| InChIKey | RFFTUSSIFSNQQL-RTPLNMEESA-N |
| XLogP | 10.21 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.95 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|