C45H78NO8P — CID 163075572
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadec-11-enoyloxypropyl] docosa-4,7,10,13,16-pentaenoate (PubChem CID 163075572) has the molecular formula C45H78NO8P and a molecular weight of 792.09 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadec-11-enoyloxypropyl] docosa-4,7,10,13,16-pentaenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadec-11-enoyloxypropyl] docosa-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 163075572 |
| Molecular Formula | C45H78NO8P |
| Molecular Weight | 792.09 g/mol |
| Exact Mass | 791.55 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadec-11-enoyloxypropyl] docosa-4,7,10,13,16-pentaenoate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C45H78NO8P/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-25-27-29-31-33-35-37-44(47)51-41-43(42-53-55(49,50)52-40-39-46)54-45(48)38-36-34-32-30-28-26-23-18-16-14-12-10-8-6-4-2/h11,13-14,16-17,19,21-22,25,27,31,33,43H,3-10,12,15,18,20,23-24,26,28-30,32,34-42,46H2,1-2H3,(H,49,50)/t43-/m1/s1 |
| InChIKey | GFXLBJUDZIYNJE-VZUYHUTRSA-N |
| XLogP | 12.27 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.09 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|