C11H13ClN2O — CID 13476546
3-(2-chloroethyl)-4-methyl-1,4-dihydroquinazolin-2-one (PubChem CID 13476546) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 3-(2-chloroethyl)-4-methyl-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-(2-chloroethyl)-4-methyl-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 13476546 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 3-(2-chloroethyl)-4-methyl-1,4-dihydroquinazolin-2-one |
| SMILES | CC1c2ccccc2NC(=O)N1CCCl |
| InChI | InChI=1S/C11H13ClN2O/c1-8-9-4-2-3-5-10(9)13-11(15)14(8)7-6-12/h2-5,8H,6-7H2,1H3,(H,13,15) |
| InChIKey | JLNXVLFNONDLMF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|