C47H78NO8P — CID 134766536
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 134766536) has the molecular formula C47H78NO8P and a molecular weight of 816.11 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 134766536 |
| Molecular Formula | C47H78NO8P |
| Molecular Weight | 816.11 g/mol |
| Exact Mass | 815.55 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(11E,14E)-icosa-11,14-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/C/C=C/CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C47H78NO8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-47(50)56-45(44-55-57(51,52)54-42-41-48)43-53-46(49)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-20,22,24,28,30,34,36,45H,3-4,6,8-10,15-16,21,23,25-27,29,31-33,35,37-44,48H2,1-2H3,(H,51,52)/b7-5+,13-11+,14-12+,19-17+,20-18+,24-22+,30-28+,36-34+/t45-/m1/s1 |
| InChIKey | SGQIECCWAOPTNL-GYXIVULWSA-N |
| XLogP | 12.61 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.11 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|