C49H78NO8P — CID 162804781
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-docosa-7,10,13,16,19-pentaenoyloxypropan-2-yl] docosa-4,7,10,13,16-pentaenoate (PubChem CID 162804781) has the molecular formula C49H78NO8P and a molecular weight of 840.14 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-docosa-7,10,13,16,19-pentaenoyloxypropan-2-yl] docosa-4,7,10,13,16-pentaenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-docosa-7,10,13,16,19-pentaenoyloxypropan-2-yl] docosa-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 162804781 |
| Molecular Formula | C49H78NO8P |
| Molecular Weight | 840.14 g/mol |
| Exact Mass | 839.55 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-docosa-7,10,13,16,19-pentaenoyloxypropan-2-yl] docosa-4,7,10,13,16-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C49H78NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-48(51)55-45-47(46-57-59(53,54)56-44-43-50)58-49(52)42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-20,23-26,29-32,36,38,47H,3-4,6,8-10,15-16,21-22,27-28,33-35,37,39-46,50H2,1-2H3,(H,53,54)/t47-/m1/s1 |
| InChIKey | PLNZHZGJERAPNP-QZNUWAOFSA-N |
| XLogP | 12.94 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.14 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|