C36H60NO8P — CID 134766703
[3-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134766703) has the molecular formula C36H60NO8P and a molecular weight of 665.85 g/mol. Its IUPAC name is [3-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134766703 |
| Molecular Formula | C36H60NO8P |
| Molecular Weight | 665.85 g/mol |
| Exact Mass | 665.41 |
| IUPAC Name | [3-[(3E,6E,9E)-dodeca-3,6,9-trienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COC(=O)C/C=C/C/C=C/C/C=C/CC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C36H60NO8P/c1-6-8-10-12-14-16-17-18-19-21-23-25-27-29-36(39)45-34(33-44-46(40,41)43-31-30-37(3,4)5)32-42-35(38)28-26-24-22-20-15-13-11-9-7-2/h8-12,14-17,20,24,26,34H,6-7,13,18-19,21-23,25,27-33H2,1-5H3/b10-8+,11-9+,14-12+,17-16+,20-15+,26-24+ |
| InChIKey | SIERINVTIYHFJB-WIVLRLIISA-N |
| XLogP | 7.71 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.85 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|