C14H14ClF3N4S — CID 13476696
butyl N-[4-chloro-2-(trifluoromethyl)phenyl]-1,2,4-triazole-1-carboximidothioate (PubChem CID 13476696) has the molecular formula C14H14ClF3N4S and a molecular weight of 362.81 g/mol. Its IUPAC name is butyl N-[4-chloro-2-(trifluoromethyl)phenyl]-1,2,4-triazole-1-carboximidothioate.
| Compound Name | butyl N-[4-chloro-2-(trifluoromethyl)phenyl]-1,2,4-triazole-1-carboximidothioate |
|---|---|
| PubChem CID | 13476696 |
| Molecular Formula | C14H14ClF3N4S |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | butyl N-[4-chloro-2-(trifluoromethyl)phenyl]-1,2,4-triazole-1-carboximidothioate |
| SMILES | CCCCS/C(=N\c1ccc(Cl)cc1C(F)(F)F)n1cncn1 |
| InChI | InChI=1S/C14H14ClF3N4S/c1-2-3-6-23-13(22-9-19-8-20-22)21-12-5-4-10(15)7-11(12)14(16,17)18/h4-5,7-9H,2-3,6H2,1H3/b21-13- |
| InChIKey | STUWFTYBYULBRS-BKUYFWCQSA-N |
| XLogP | 5.02 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|