C14H13ClF3N3O — CID 14327498
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-ethoxy-1-imidazol-1-ylethanimine (PubChem CID 14327498) has the molecular formula C14H13ClF3N3O and a molecular weight of 331.73 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-ethoxy-1-imidazol-1-ylethanimine.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-ethoxy-1-imidazol-1-ylethanimine |
|---|---|
| PubChem CID | 14327498 |
| Molecular Formula | C14H13ClF3N3O |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-ethoxy-1-imidazol-1-ylethanimine |
| SMILES | CCOC/C(=N\c1ccc(Cl)cc1C(F)(F)F)n1ccnc1 |
| InChI | InChI=1S/C14H13ClF3N3O/c1-2-22-8-13(21-6-5-19-9-21)20-12-4-3-10(15)7-11(12)14(16,17)18/h3-7,9H,2,8H2,1H3/b20-13+ |
| InChIKey | NQPGZZOSPQMMJW-DEDYPNTBSA-N |
| XLogP | 4.17 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|