C44H83O10P — CID 134775455
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-octadec-11-enoyl]oxypropan-2-yl] (E)-icos-11-enoate (PubChem CID 134775455) has the molecular formula C44H83O10P and a molecular weight of 803.11 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-octadec-11-enoyl]oxypropan-2-yl] (E)-icos-11-enoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-octadec-11-enoyl]oxypropan-2-yl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134775455 |
| Molecular Formula | C44H83O10P |
| Molecular Weight | 803.11 g/mol |
| Exact Mass | 802.57 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(E)-octadec-11-enoyl]oxypropan-2-yl] (E)-icos-11-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C44H83O10P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-44(48)54-42(40-53-55(49,50)52-38-41(46)37-45)39-51-43(47)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h14,16-17,19,41-42,45-46H,3-13,15,18,20-40H2,1-2H3,(H,49,50)/b16-14+,19-17+/t41-,42+/m0/s1 |
| InChIKey | WDUXATGRAUOJDL-DAAOJMTRSA-N |
| XLogP | 11.78 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.11 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|