C44H79O13P — CID 134778122
[2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-nonadec-9-enoate (PubChem CID 134778122) has the molecular formula C44H79O13P and a molecular weight of 847.08 g/mol. Its IUPAC name is [2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-nonadec-9-enoate.
| Compound Name | [2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-nonadec-9-enoate |
|---|---|
| PubChem CID | 134778122 |
| Molecular Formula | C44H79O13P |
| Molecular Weight | 847.08 g/mol |
| Exact Mass | 846.53 |
| IUPAC Name | [2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-nonadec-9-enoate |
| SMILES | CCCCCCCC/C=C/C/C=C/CCC(=O)OC(COC(=O)CCCCCCC/C=C/CCCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O |
| InChI | InChI=1S/C44H79O13P/c1-3-5-7-9-11-13-15-17-18-19-21-22-24-26-28-30-32-37(45)54-34-36(35-55-58(52,53)57-44-42(50)40(48)39(47)41(49)43(44)51)56-38(46)33-31-29-27-25-23-20-16-14-12-10-8-6-4-2/h18-20,23,27,29,36,39-44,47-51H,3-17,21-22,24-26,28,30-35H2,1-2H3,(H,52,53)/b19-18+,23-20+,29-27+/t36?,39?,40-,41?,42?,43?,44?/m0/s1 |
| InChIKey | XDOBSQCNLIBAAJ-SNZZVLSCSA-N |
| XLogP | 8.22 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.08 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|