C45H81O13P — CID 134784372
[2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-icos-11-enoate (PubChem CID 134784372) has the molecular formula C45H81O13P and a molecular weight of 861.10 g/mol. Its IUPAC name is [2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-icos-11-enoate.
| Compound Name | [2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134784372 |
| Molecular Formula | C45H81O13P |
| Molecular Weight | 861.10 g/mol |
| Exact Mass | 860.54 |
| IUPAC Name | [2-[(4E,7E)-hexadeca-4,7-dienoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (E)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C/C/C=C/CCC(=O)OC(COC(=O)CCCCCCCCC/C=C/CCCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O |
| InChI | InChI=1S/C45H81O13P/c1-3-5-7-9-11-13-15-17-18-19-20-22-23-25-27-29-31-33-38(46)55-35-37(36-56-59(53,54)58-45-43(51)41(49)40(48)42(50)44(45)52)57-39(47)34-32-30-28-26-24-21-16-14-12-10-8-6-4-2/h17-18,21,24,28,30,37,40-45,48-52H,3-16,19-20,22-23,25-27,29,31-36H2,1-2H3,(H,53,54)/b18-17+,24-21+,30-28+/t37?,40?,41-,42?,43?,44?,45?/m0/s1 |
| InChIKey | ZJWOLNUVYVDBFL-YQPDWXBXSA-N |
| XLogP | 8.61 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.10 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|