C41H72NO8P — CID 134778716
[(2R)-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134778716) has the molecular formula C41H72NO8P and a molecular weight of 738.00 g/mol. Its IUPAC name is [(2R)-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134778716 |
| Molecular Formula | C41H72NO8P |
| Molecular Weight | 738.00 g/mol |
| Exact Mass | 737.50 |
| IUPAC Name | [(2R)-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C/CCCCC |
| InChI | InChI=1S/C41H72NO8P/c1-6-8-10-12-14-16-18-20-21-22-24-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42(3,4)5)50-41(44)34-32-30-28-26-23-19-17-15-13-11-9-7-2/h8,10,14-17,20-21,24-25,39H,6-7,9,11-13,18-19,22-23,26-38H2,1-5H3/b10-8+,16-14+,17-15+,21-20+,25-24+/t39-/m1/s1 |
| InChIKey | XJQMOSXZKQGRNI-DAMYFBMASA-N |
| XLogP | 9.88 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.00 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|